C22H24N5O3P — CID 71471355
N-[3-[[4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide (PubChem CID 71471355) has the molecular formula C22H24N5O3P and a molecular weight of 437.44 g/mol. Its IUPAC name is N-[3-[[4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide.
| Compound Name | N-[3-[[4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71471355 |
| Molecular Formula | C22H24N5O3P |
| Molecular Weight | 437.44 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[3-[[4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]-4-methoxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc(OC)c(Nc2nccc(Nc3ccccc3P(C)(C)=O)n2)c1 |
| InChI | InChI=1S/C22H24N5O3P/c1-5-21(28)24-15-10-11-18(30-2)17(14-15)26-22-23-13-12-20(27-22)25-16-8-6-7-9-19(16)31(3,4)29/h5-14H,1H2,2-4H3,(H,24,28)(H2,23,25,26,27) |
| InChIKey | DVBGQPJSSHZFQM-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 105.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.44 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|