C15H19N4OP — CID 142365892
4-N-(2-dimethylphosphorylphenyl)-2-N-prop-1-en-2-ylpyrimidine-2,4-diamine (PubChem CID 142365892) has the molecular formula C15H19N4OP and a molecular weight of 302.32 g/mol. Its IUPAC name is 4-N-(2-dimethylphosphorylphenyl)-2-N-prop-1-en-2-ylpyrimidine-2,4-diamine.
| Compound Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-prop-1-en-2-ylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142365892 |
| Molecular Formula | C15H19N4OP |
| Molecular Weight | 302.32 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | 4-N-(2-dimethylphosphorylphenyl)-2-N-prop-1-en-2-ylpyrimidine-2,4-diamine |
| SMILES | C=C(C)Nc1nccc(Nc2ccccc2P(C)(C)=O)n1 |
| InChI | InChI=1S/C15H19N4OP/c1-11(2)17-15-16-10-9-14(19-15)18-12-7-5-6-8-13(12)21(3,4)20/h5-10H,1H2,2-4H3,(H2,16,17,18,19) |
| InChIKey | AZVACYCGGUKOKY-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|