C31H40N7O2P — CID 155183853
N-[2-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-5-[[4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide (PubChem CID 155183853) has the molecular formula C31H40N7O2P and a molecular weight of 573.68 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-5-[[4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide.
| Compound Name | N-[2-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-5-[[4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 155183853 |
| Molecular Formula | C31H40N7O2P |
| Molecular Weight | 573.68 g/mol |
| Exact Mass | 573.30 |
| IUPAC Name | N-[2-[2-(dimethylamino)-7-azaspiro[3.5]nonan-7-yl]-5-[[4-(2-dimethylphosphorylanilino)pyrimidin-2-yl]amino]phenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(Nc2nccc(Nc3ccccc3P(C)(C)=O)n2)ccc1N1CCC2(CC1)CC(N(C)C)C2 |
| InChI | InChI=1S/C31H40N7O2P/c1-6-29(39)35-25-19-22(11-12-26(25)38-17-14-31(15-18-38)20-23(21-31)37(2)3)33-30-32-16-13-28(36-30)34-24-9-7-8-10-27(24)41(4,5)40/h6-13,16,19,23H,1,14-15,17-18,20-21H2,2-5H3,(H,35,39)(H2,32,33,34,36) |
| InChIKey | ZURNYFZEBCUXQN-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 102.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|