C11H12ClN4OP — CID 118147702
4-chloro-N-(2-dimethylphosphorylphenyl)-1,3,5-triazin-2-amine (PubChem CID 118147702) has the molecular formula C11H12ClN4OP and a molecular weight of 282.67 g/mol. Its IUPAC name is 4-chloro-N-(2-dimethylphosphorylphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(2-dimethylphosphorylphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 118147702 |
| Molecular Formula | C11H12ClN4OP |
| Molecular Weight | 282.67 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 4-chloro-N-(2-dimethylphosphorylphenyl)-1,3,5-triazin-2-amine |
| SMILES | CP(C)(=O)c1ccccc1Nc1ncnc(Cl)n1 |
| InChI | InChI=1S/C11H12ClN4OP/c1-18(2,17)9-6-4-3-5-8(9)15-11-14-7-13-10(12)16-11/h3-7H,1-2H3,(H,13,14,15,16) |
| InChIKey | MAGHJTPOJXXRQO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.67 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|