About [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol
[2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol (PubChem CID 123825024) has the molecular formula C10H9ClN4O
and a molecular weight of 236.66 g/mol. Its IUPAC name is [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol.
Molecular Properties
| Compound Name | [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol |
| PubChem CID | 123825024 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol |
| SMILES | OCc1ccccc1Nc1ncnc(Cl)n1 |
| InChI | InChI=1S/C10H9ClN4O/c11-9-12-6-13-10(15-9)14-8-4-2-1-3-7(8)5-16/h1-4,6,16H,5H2,(H,12,13,14,15) |
| InChIKey | WFEAQEAQYKJPLQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol?
The IUPAC name of [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol (CID 123825024) is [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol.
What is the SMILES notation for [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol?
The canonical SMILES for [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol is OCc1ccccc1Nc1ncnc(Cl)n1.
What is the InChIKey of [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol?
The InChIKey is WFEAQEAQYKJPLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9ClN4O/c11-9-12-6-13-10(15-9)14-8-4-2-1-3-7(8)5-16/h1-4,6,16H,5H2,(H,12,13,14,15).
What are the key properties of [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol?
[2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol has a molecular weight of 236.66 g/mol, XLogP of 1.76, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol is sourced from PubChem (CID 123825024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).