C10H9ClN4O — CID 123825024
[2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol (PubChem CID 123825024) has the molecular formula C10H9ClN4O and a molecular weight of 236.66 g/mol. Its IUPAC name is [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol.
| Compound Name | [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol |
|---|---|
| PubChem CID | 123825024 |
| Molecular Formula | C10H9ClN4O |
| Molecular Weight | 236.66 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | [2-[(4-chloro-1,3,5-triazin-2-yl)amino]phenyl]methanol |
| SMILES | OCc1ccccc1Nc1ncnc(Cl)n1 |
| InChI | InChI=1S/C10H9ClN4O/c11-9-12-6-13-10(15-9)14-8-4-2-1-3-7(8)5-16/h1-4,6,16H,5H2,(H,12,13,14,15) |
| InChIKey | WFEAQEAQYKJPLQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.66 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |