C16H13ClN4O — CID 22496155
4-chloro-N-(4-phenylmethoxyphenyl)-1,3,5-triazin-2-amine (PubChem CID 22496155) has the molecular formula C16H13ClN4O and a molecular weight of 312.76 g/mol. Its IUPAC name is 4-chloro-N-(4-phenylmethoxyphenyl)-1,3,5-triazin-2-amine.
| Compound Name | 4-chloro-N-(4-phenylmethoxyphenyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 22496155 |
| Molecular Formula | C16H13ClN4O |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 4-chloro-N-(4-phenylmethoxyphenyl)-1,3,5-triazin-2-amine |
| SMILES | Clc1ncnc(Nc2ccc(OCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C16H13ClN4O/c17-15-18-11-19-16(21-15)20-13-6-8-14(9-7-13)22-10-12-4-2-1-3-5-12/h1-9,11H,10H2,(H,18,19,20,21) |
| InChIKey | VWZCSKCQBDJIQG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |