C24H21N3O — CID 66493776
N-(4-methylphenyl)-4-(4-phenylmethoxyphenyl)pyrimidin-2-amine (PubChem CID 66493776) has the molecular formula C24H21N3O and a molecular weight of 367.45 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-(4-phenylmethoxyphenyl)pyrimidin-2-amine.
| Compound Name | N-(4-methylphenyl)-4-(4-phenylmethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66493776 |
| Molecular Formula | C24H21N3O |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | N-(4-methylphenyl)-4-(4-phenylmethoxyphenyl)pyrimidin-2-amine |
| SMILES | Cc1ccc(Nc2nccc(-c3ccc(OCc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H21N3O/c1-18-7-11-21(12-8-18)26-24-25-16-15-23(27-24)20-9-13-22(14-10-20)28-17-19-5-3-2-4-6-19/h2-16H,17H2,1H3,(H,25,26,27) |
| InChIKey | LURAFSZFLQKBTI-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |