C23H28N4O — CID 112901232
2-N-(4-phenylmethoxyphenyl)-4-N,4-N-dipropylpyrimidine-2,4-diamine (PubChem CID 112901232) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-N-(4-phenylmethoxyphenyl)-4-N,4-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 2-N-(4-phenylmethoxyphenyl)-4-N,4-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112901232 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-N-(4-phenylmethoxyphenyl)-4-N,4-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCN(CCC)c1ccnc(Nc2ccc(OCc3ccccc3)cc2)n1 |
| InChI | InChI=1S/C23H28N4O/c1-3-16-27(17-4-2)22-14-15-24-23(26-22)25-20-10-12-21(13-11-20)28-18-19-8-6-5-7-9-19/h5-15H,3-4,16-18H2,1-2H3,(H,24,25,26) |
| InChIKey | PQXOMNNUZGOSBQ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |