C19H26N4O2 — CID 112901242
ethyl 4-[[4-(dipropylamino)pyrimidin-2-yl]amino]benzoate (PubChem CID 112901242) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethyl 4-[[4-(dipropylamino)pyrimidin-2-yl]amino]benzoate.
| Compound Name | ethyl 4-[[4-(dipropylamino)pyrimidin-2-yl]amino]benzoate |
|---|---|
| PubChem CID | 112901242 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | ethyl 4-[[4-(dipropylamino)pyrimidin-2-yl]amino]benzoate |
| SMILES | CCCN(CCC)c1ccnc(Nc2ccc(C(=O)OCC)cc2)n1 |
| InChI | InChI=1S/C19H26N4O2/c1-4-13-23(14-5-2)17-11-12-20-19(22-17)21-16-9-7-15(8-10-16)18(24)25-6-3/h7-12H,4-6,13-14H2,1-3H3,(H,20,21,22) |
| InChIKey | YONUJYWUHZEKJT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |