C20H31N5 — CID 112901225
2-N-[4-(diethylamino)phenyl]-4-N,4-N-dipropylpyrimidine-2,4-diamine (PubChem CID 112901225) has the molecular formula C20H31N5 and a molecular weight of 341.50 g/mol. Its IUPAC name is 2-N-[4-(diethylamino)phenyl]-4-N,4-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-(diethylamino)phenyl]-4-N,4-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 112901225 |
| Molecular Formula | C20H31N5 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 2-N-[4-(diethylamino)phenyl]-4-N,4-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCN(CCC)c1ccnc(Nc2ccc(N(CC)CC)cc2)n1 |
| InChI | InChI=1S/C20H31N5/c1-5-15-25(16-6-2)19-13-14-21-20(23-19)22-17-9-11-18(12-10-17)24(7-3)8-4/h9-14H,5-8,15-16H2,1-4H3,(H,21,22,23) |
| InChIKey | VGBNHPHSIUYMIO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|