C10H18N4 — CID 80775087
4-N-ethyl-2-N-methyl-4-N-propylpyrimidine-2,4-diamine (PubChem CID 80775087) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is 4-N-ethyl-2-N-methyl-4-N-propylpyrimidine-2,4-diamine.
| Compound Name | 4-N-ethyl-2-N-methyl-4-N-propylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 80775087 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | 4-N-ethyl-2-N-methyl-4-N-propylpyrimidine-2,4-diamine |
| SMILES | CCCN(CC)c1ccnc(NC)n1 |
| InChI | InChI=1S/C10H18N4/c1-4-8-14(5-2)9-6-7-12-10(11-3)13-9/h6-7H,4-5,8H2,1-3H3,(H,11,12,13) |
| InChIKey | AMTBQQYTPQISDI-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |