C23H19N3O — CID 166873727
6-(4-phenylmethoxyphenyl)-N-pyridin-4-ylpyridin-2-amine (PubChem CID 166873727) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is 6-(4-phenylmethoxyphenyl)-N-pyridin-4-ylpyridin-2-amine.
| Compound Name | 6-(4-phenylmethoxyphenyl)-N-pyridin-4-ylpyridin-2-amine |
|---|---|
| PubChem CID | 166873727 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | 6-(4-phenylmethoxyphenyl)-N-pyridin-4-ylpyridin-2-amine |
| SMILES | c1ccc(COc2ccc(-c3cccc(Nc4ccncc4)n3)cc2)cc1 |
| InChI | InChI=1S/C23H19N3O/c1-2-5-18(6-3-1)17-27-21-11-9-19(10-12-21)22-7-4-8-23(26-22)25-20-13-15-24-16-14-20/h1-16H,17H2,(H,24,25,26) |
| InChIKey | DJFFKWVKVUEQNA-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |