C24H22N4O — CID 143521008
4-[4-(ethylamino)phenyl]-N-(4-phenoxyphenyl)pyrimidin-2-amine (PubChem CID 143521008) has the molecular formula C24H22N4O and a molecular weight of 382.47 g/mol. Its IUPAC name is 4-[4-(ethylamino)phenyl]-N-(4-phenoxyphenyl)pyrimidin-2-amine.
| Compound Name | 4-[4-(ethylamino)phenyl]-N-(4-phenoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 143521008 |
| Molecular Formula | C24H22N4O |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 4-[4-(ethylamino)phenyl]-N-(4-phenoxyphenyl)pyrimidin-2-amine |
| SMILES | CCNc1ccc(-c2ccnc(Nc3ccc(Oc4ccccc4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H22N4O/c1-2-25-19-10-8-18(9-11-19)23-16-17-26-24(28-23)27-20-12-14-22(15-13-20)29-21-6-4-3-5-7-21/h3-17,25H,2H2,1H3,(H,26,27,28) |
| InChIKey | AZEONZDXWNHPSR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 59.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |