C26H25N3O4 — CID 10275222
N-(3-phenylmethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine (PubChem CID 10275222) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is N-(3-phenylmethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine.
| Compound Name | N-(3-phenylmethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 10275222 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | N-(3-phenylmethoxyphenyl)-4-(3,4,5-trimethoxyphenyl)pyrimidin-2-amine |
| SMILES | COc1cc(-c2ccnc(Nc3cccc(OCc4ccccc4)c3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C26H25N3O4/c1-30-23-14-19(15-24(31-2)25(23)32-3)22-12-13-27-26(29-22)28-20-10-7-11-21(16-20)33-17-18-8-5-4-6-9-18/h4-16H,17H2,1-3H3,(H,27,28,29) |
| InChIKey | AXBTTYUMRZNTKU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 74.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |