C30H27N5O2 — CID 173488375
4-[4-amino-3-[methoxy(2H-pyridin-5-ylidene)methyl]phenyl]-N-(3-phenylmethoxyphenyl)pyrimidin-2-amine (PubChem CID 173488375) has the molecular formula C30H27N5O2 and a molecular weight of 489.58 g/mol. Its IUPAC name is 4-[4-amino-3-[methoxy(2H-pyridin-5-ylidene)methyl]phenyl]-N-(3-phenylmethoxyphenyl)pyrimidin-2-amine.
| Compound Name | 4-[4-amino-3-[methoxy(2H-pyridin-5-ylidene)methyl]phenyl]-N-(3-phenylmethoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 173488375 |
| Molecular Formula | C30H27N5O2 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | 4-[4-amino-3-[methoxy(2H-pyridin-5-ylidene)methyl]phenyl]-N-(3-phenylmethoxyphenyl)pyrimidin-2-amine |
| SMILES | COC(=C1C=CCN=C1)c1cc(-c2ccnc(Nc3cccc(OCc4ccccc4)c3)n2)ccc1N |
| InChI | InChI=1S/C30H27N5O2/c1-36-29(23-9-6-15-32-19-23)26-17-22(12-13-27(26)31)28-14-16-33-30(35-28)34-24-10-5-11-25(18-24)37-20-21-7-3-2-4-8-21/h2-14,16-19H,15,20,31H2,1H3,(H,33,34,35) |
| InChIKey | PECFYRNGACNCSQ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 94.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|