C23H17N4O3S- — CID 89175574
3-[[4-(4-amino-3-benzoylphenyl)pyrimidin-2-yl]amino]benzenesulfinate (PubChem CID 89175574) has the molecular formula C23H17N4O3S- and a molecular weight of 429.48 g/mol. Its IUPAC name is 3-[[4-(4-amino-3-benzoylphenyl)pyrimidin-2-yl]amino]benzenesulfinate.
| Compound Name | 3-[[4-(4-amino-3-benzoylphenyl)pyrimidin-2-yl]amino]benzenesulfinate |
|---|---|
| PubChem CID | 89175574 |
| Molecular Formula | C23H17N4O3S- |
| Molecular Weight | 429.48 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 3-[[4-(4-amino-3-benzoylphenyl)pyrimidin-2-yl]amino]benzenesulfinate |
| SMILES | Nc1ccc(-c2ccnc(Nc3cccc(S(=O)[O-])c3)n2)cc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H18N4O3S/c24-20-10-9-16(13-19(20)22(28)15-5-2-1-3-6-15)21-11-12-25-23(27-21)26-17-7-4-8-18(14-17)31(29)30/h1-14H,24H2,(H,29,30)(H,25,26,27)/p-1 |
| InChIKey | DUMBYSSOOHAELJ-UHFFFAOYSA-M |
| XLogP | 3.94 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.48 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|