C18H12F3N5OS — CID 170970839
4-(3H-benzimidazol-5-yl)-N-[3-(trifluoromethylsulfinyl)phenyl]pyrimidin-2-amine (PubChem CID 170970839) has the molecular formula C18H12F3N5OS and a molecular weight of 403.39 g/mol. Its IUPAC name is 4-(3H-benzimidazol-5-yl)-N-[3-(trifluoromethylsulfinyl)phenyl]pyrimidin-2-amine.
| Compound Name | 4-(3H-benzimidazol-5-yl)-N-[3-(trifluoromethylsulfinyl)phenyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 170970839 |
| Molecular Formula | C18H12F3N5OS |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-(3H-benzimidazol-5-yl)-N-[3-(trifluoromethylsulfinyl)phenyl]pyrimidin-2-amine |
| SMILES | O=S(c1cccc(Nc2nccc(-c3ccc4nc[nH]c4c3)n2)c1)C(F)(F)F |
| InChI | InChI=1S/C18H12F3N5OS/c19-18(20,21)28(27)13-3-1-2-12(9-13)25-17-22-7-6-14(26-17)11-4-5-15-16(8-11)24-10-23-15/h1-10H,(H,23,24)(H,22,25,26) |
| InChIKey | GYJWOONJCYCCON-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |