C17H14N6S — CID 170970796
S-[3-[[4-(3H-benzimidazol-5-yl)pyrimidin-2-yl]amino]phenyl]thiohydroxylamine (PubChem CID 170970796) has the molecular formula C17H14N6S and a molecular weight of 334.41 g/mol. Its IUPAC name is S-[3-[[4-(3H-benzimidazol-5-yl)pyrimidin-2-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[3-[[4-(3H-benzimidazol-5-yl)pyrimidin-2-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 170970796 |
| Molecular Formula | C17H14N6S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | S-[3-[[4-(3H-benzimidazol-5-yl)pyrimidin-2-yl]amino]phenyl]thiohydroxylamine |
| SMILES | NSc1cccc(Nc2nccc(-c3ccc4nc[nH]c4c3)n2)c1 |
| InChI | InChI=1S/C17H14N6S/c18-24-13-3-1-2-12(9-13)22-17-19-7-6-14(23-17)11-4-5-15-16(8-11)21-10-20-15/h1-10H,18H2,(H,20,21)(H,19,22,23) |
| InChIKey | PBXORKBWRZUIQH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|