C17H18N6S — CID 123513402
S-[3-[[4-(4-amino-N-methylanilino)pyrimidin-2-yl]amino]phenyl]thiohydroxylamine (PubChem CID 123513402) has the molecular formula C17H18N6S and a molecular weight of 338.44 g/mol. Its IUPAC name is S-[3-[[4-(4-amino-N-methylanilino)pyrimidin-2-yl]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[3-[[4-(4-amino-N-methylanilino)pyrimidin-2-yl]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 123513402 |
| Molecular Formula | C17H18N6S |
| Molecular Weight | 338.44 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | S-[3-[[4-(4-amino-N-methylanilino)pyrimidin-2-yl]amino]phenyl]thiohydroxylamine |
| SMILES | CN(c1ccc(N)cc1)c1ccnc(Nc2cccc(SN)c2)n1 |
| InChI | InChI=1S/C17H18N6S/c1-23(14-7-5-12(18)6-8-14)16-9-10-20-17(22-16)21-13-3-2-4-15(11-13)24-19/h2-11H,18-19H2,1H3,(H,20,21,22) |
| InChIKey | NNRLNIWFFYVZSV-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|