C18H19N5 — CID 123582073
4-N-(4-aminophenyl)-4-N-methyl-2-N-(2-methylphenyl)pyrimidine-2,4-diamine (PubChem CID 123582073) has the molecular formula C18H19N5 and a molecular weight of 305.39 g/mol. Its IUPAC name is 4-N-(4-aminophenyl)-4-N-methyl-2-N-(2-methylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-(4-aminophenyl)-4-N-methyl-2-N-(2-methylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 123582073 |
| Molecular Formula | C18H19N5 |
| Molecular Weight | 305.39 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 4-N-(4-aminophenyl)-4-N-methyl-2-N-(2-methylphenyl)pyrimidine-2,4-diamine |
| SMILES | Cc1ccccc1Nc1nccc(N(C)c2ccc(N)cc2)n1 |
| InChI | InChI=1S/C18H19N5/c1-13-5-3-4-6-16(13)21-18-20-12-11-17(22-18)23(2)15-9-7-14(19)8-10-15/h3-12H,19H2,1-2H3,(H,20,21,22) |
| InChIKey | JHESCLRRDNGQRY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|