C24H23N7O3S — CID 129077091
1-[4-[methyl-[2-(2-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-3-phenylurea (PubChem CID 129077091) has the molecular formula C24H23N7O3S and a molecular weight of 489.56 g/mol. Its IUPAC name is 1-[4-[methyl-[2-(2-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-3-phenylurea.
| Compound Name | 1-[4-[methyl-[2-(2-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 129077091 |
| Molecular Formula | C24H23N7O3S |
| Molecular Weight | 489.56 g/mol |
| Exact Mass | 489.16 |
| IUPAC Name | 1-[4-[methyl-[2-(2-sulfamoylanilino)pyrimidin-4-yl]amino]phenyl]-3-phenylurea |
| SMILES | CN(c1ccc(NC(=O)Nc2ccccc2)cc1)c1ccnc(Nc2ccccc2S(N)(=O)=O)n1 |
| InChI | InChI=1S/C24H23N7O3S/c1-31(19-13-11-18(12-14-19)28-24(32)27-17-7-3-2-4-8-17)22-15-16-26-23(30-22)29-20-9-5-6-10-21(20)35(25,33)34/h2-16H,1H3,(H2,25,33,34)(H,26,29,30)(H2,27,28,32) |
| InChIKey | CRZNZICBYQMNGB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 142.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.56 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |