C24H22N6O4S — CID 118514070
[4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]-2-phenylphenyl] carbamate (PubChem CID 118514070) has the molecular formula C24H22N6O4S and a molecular weight of 490.55 g/mol. Its IUPAC name is [4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]-2-phenylphenyl] carbamate.
| Compound Name | [4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]-2-phenylphenyl] carbamate |
|---|---|
| PubChem CID | 118514070 |
| Molecular Formula | C24H22N6O4S |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | [4-[methyl-[2-(3-sulfamoylanilino)pyrimidin-4-yl]amino]-2-phenylphenyl] carbamate |
| SMILES | CN(c1ccc(OC(N)=O)c(-c2ccccc2)c1)c1ccnc(Nc2cccc(S(N)(=O)=O)c2)n1 |
| InChI | InChI=1S/C24H22N6O4S/c1-30(18-10-11-21(34-23(25)31)20(15-18)16-6-3-2-4-7-16)22-12-13-27-24(29-22)28-17-8-5-9-19(14-17)35(26,32)33/h2-15H,1H3,(H2,25,31)(H2,26,32,33)(H,27,28,29) |
| InChIKey | OPVASVQDKBIGRI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |