C17H18N5S+ — CID 144959182
[3-[[4-(4-amino-N-methylanilino)pyrimidin-2-yl]amino]phenyl]sulfanium (PubChem CID 144959182) has the molecular formula C17H18N5S+ and a molecular weight of 324.43 g/mol. Its IUPAC name is [3-[[4-(4-amino-N-methylanilino)pyrimidin-2-yl]amino]phenyl]sulfanium.
| Compound Name | [3-[[4-(4-amino-N-methylanilino)pyrimidin-2-yl]amino]phenyl]sulfanium |
|---|---|
| PubChem CID | 144959182 |
| Molecular Formula | C17H18N5S+ |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | [3-[[4-(4-amino-N-methylanilino)pyrimidin-2-yl]amino]phenyl]sulfanium |
| SMILES | CN(c1ccc(N)cc1)c1ccnc(Nc2cccc([SH2+])c2)n1 |
| InChI | InChI=1S/C17H17N5S/c1-22(14-7-5-12(18)6-8-14)16-9-10-19-17(21-16)20-13-3-2-4-15(23)11-13/h2-11,23H,18H2,1H3,(H,19,20,21)/p+1 |
| InChIKey | HXLSDYBLLCFBHC-UHFFFAOYSA-O |
| XLogP | 2.94 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|