C27H23F4N5O3S — CID 157495271
4-[4-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-2-oxopropyl]-N-methylanilino]-2-[3-(sulfinoamino)anilino]pyrimidine (PubChem CID 157495271) has the molecular formula C27H23F4N5O3S and a molecular weight of 573.57 g/mol. Its IUPAC name is 4-[4-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-2-oxopropyl]-N-methylanilino]-2-[3-(sulfinoamino)anilino]pyrimidine.
| Compound Name | 4-[4-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-2-oxopropyl]-N-methylanilino]-2-[3-(sulfinoamino)anilino]pyrimidine |
|---|---|
| PubChem CID | 157495271 |
| Molecular Formula | C27H23F4N5O3S |
| Molecular Weight | 573.57 g/mol |
| Exact Mass | 573.15 |
| IUPAC Name | 4-[4-[3-[2-fluoro-5-(trifluoromethyl)phenyl]-2-oxopropyl]-N-methylanilino]-2-[3-(sulfinoamino)anilino]pyrimidine |
| SMILES | CN(c1ccc(CC(=O)Cc2cc(C(F)(F)F)ccc2F)cc1)c1ccnc(Nc2cccc(NS(=O)O)c2)n1 |
| InChI | InChI=1S/C27H23F4N5O3S/c1-36(25-11-12-32-26(34-25)33-20-3-2-4-21(16-20)35-40(38)39)22-8-5-17(6-9-22)13-23(37)15-18-14-19(27(29,30)31)7-10-24(18)28/h2-12,14,16,35H,13,15H2,1H3,(H,38,39)(H,32,33,34) |
| InChIKey | UXYLWNCDQSYTNR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.57 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|