C25H21F4N7OS — CID 142273204
1-[3-[[2-(3-aminosulfanylanilino)pyrimidin-4-yl]-methylamino]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea (PubChem CID 142273204) has the molecular formula C25H21F4N7OS and a molecular weight of 543.55 g/mol. Its IUPAC name is 1-[3-[[2-(3-aminosulfanylanilino)pyrimidin-4-yl]-methylamino]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-[[2-(3-aminosulfanylanilino)pyrimidin-4-yl]-methylamino]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 142273204 |
| Molecular Formula | C25H21F4N7OS |
| Molecular Weight | 543.55 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | 1-[3-[[2-(3-aminosulfanylanilino)pyrimidin-4-yl]-methylamino]phenyl]-3-[2-fluoro-5-(trifluoromethyl)phenyl]urea |
| SMILES | CN(c1cccc(NC(=O)Nc2cc(C(F)(F)F)ccc2F)c1)c1ccnc(Nc2cccc(SN)c2)n1 |
| InChI | InChI=1S/C25H21F4N7OS/c1-36(22-10-11-31-23(35-22)32-17-5-3-7-19(14-17)38-30)18-6-2-4-16(13-18)33-24(37)34-21-12-15(25(27,28)29)8-9-20(21)26/h2-14H,30H2,1H3,(H,31,32,35)(H2,33,34,37) |
| InChIKey | MRMOHHBKLJYIPN-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 108.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.55 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|