C13H9F4N3O — CID 141145746
1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-pyridin-2-ylurea (PubChem CID 141145746) has the molecular formula C13H9F4N3O and a molecular weight of 299.23 g/mol. Its IUPAC name is 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-pyridin-2-ylurea.
| Compound Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-pyridin-2-ylurea |
|---|---|
| PubChem CID | 141145746 |
| Molecular Formula | C13H9F4N3O |
| Molecular Weight | 299.23 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 1-[2-fluoro-5-(trifluoromethyl)phenyl]-3-pyridin-2-ylurea |
| SMILES | O=C(Nc1ccccn1)Nc1cc(C(F)(F)F)ccc1F |
| InChI | InChI=1S/C13H9F4N3O/c14-9-5-4-8(13(15,16)17)7-10(9)19-12(21)20-11-3-1-2-6-18-11/h1-7H,(H2,18,19,20,21) |
| InChIKey | MOXCEZJLLQHLPI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.23 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |