About 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea
1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea (PubChem CID 52521709) has the molecular formula C18H20F3N3O
and a molecular weight of 351.37 g/mol. Its IUPAC name is 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea.
Molecular Properties
| Compound Name | 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea |
| PubChem CID | 52521709 |
| Molecular Formula | C18H20F3N3O |
| Molecular Weight | 351.37 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea |
| SMILES | CC(C)(C)[C@H](NC(=O)Nc1ccccn1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H20F3N3O/c1-17(2,3)15(12-7-6-8-13(11-12)18(19,20)21)24-16(25)23-14-9-4-5-10-22-14/h4-11,15H,1-3H3,(H2,22,23,24,25)/t15-/m1/s1 |
| InChIKey | XETITFUORDMXRU-OAHLLOKOSA-N |
| XLogP | 5.01 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 351.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea?
The IUPAC name of 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea (CID 52521709) is 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea.
What is the SMILES notation for 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea?
The canonical SMILES for 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea is CC(C)(C)[C@H](NC(=O)Nc1ccccn1)c1cccc(C(F)(F)F)c1.
What is the InChIKey of 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea?
The InChIKey is XETITFUORDMXRU-OAHLLOKOSA-N. The full InChI is InChI=1S/C18H20F3N3O/c1-17(2,3)15(12-7-6-8-13(11-12)18(19,20)21)24-16(25)23-14-9-4-5-10-22-14/h4-11,15H,1-3H3,(H2,22,23,24,25)/t15-/m1/s1.
What are the key properties of 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea?
1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea has a molecular weight of 351.37 g/mol, XLogP of 5.01, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-2,2-dimethyl-1-[3-(trifluoromethyl)phenyl]propyl]-3-pyridin-2-ylurea is sourced from PubChem (CID 52521709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).