C31H30F5N8O4S- — CID 173493785
CID 173493785 (PubChem CID 173493785) has the molecular formula C31H30F5N8O4S- and a molecular weight of 705.69 g/mol.
| Compound Name | CID 173493785 |
|---|---|
| PubChem CID | 173493785 |
| Molecular Formula | C31H30F5N8O4S- |
| Molecular Weight | 705.69 g/mol |
| Exact Mass | 705.20 |
| IUPAC Name | — |
| SMILES | CCOC(=O)/N=[S-](=O)/c1cccc(Nc2ncc(-c3ccc(NC(=O)Nc4cc(C(F)(F)F)ccc4F)c(F)c3)c(NCCN(C)C)n2)c1 |
| InChI | InChI=1S/C31H30F5N8O4S/c1-4-48-30(46)43-49(47)21-7-5-6-20(16-21)39-28-38-17-22(27(42-28)37-12-13-44(2)3)18-8-11-25(24(33)14-18)40-29(45)41-26-15-19(31(34,35)36)9-10-23(26)32/h5-11,14-17H,4,12-13H2,1-3H3,(H2,40,41,45)(H2,37,38,39,42)/q-1 |
| InChIKey | DSWHHWYKIQKVKF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 149.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.69 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|