C24H28ClFN6O — CID 59353251
4-[2-(3-chloro-4-fluoroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]-N-ethylbenzamide (PubChem CID 59353251) has the molecular formula C24H28ClFN6O and a molecular weight of 470.98 g/mol. Its IUPAC name is 4-[2-(3-chloro-4-fluoroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]-N-ethylbenzamide.
| Compound Name | 4-[2-(3-chloro-4-fluoroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]-N-ethylbenzamide |
|---|---|
| PubChem CID | 59353251 |
| Molecular Formula | C24H28ClFN6O |
| Molecular Weight | 470.98 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 4-[2-(3-chloro-4-fluoroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1ccc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2NCCCN(C)C)cc1 |
| InChI | InChI=1S/C24H28ClFN6O/c1-4-27-23(33)17-8-6-16(7-9-17)19-15-29-24(30-18-10-11-21(26)20(25)14-18)31-22(19)28-12-5-13-32(2)3/h6-11,14-15H,4-5,12-13H2,1-3H3,(H,27,33)(H2,28,29,30,31) |
| InChIKey | WPSZRFCDDXJOQY-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.98 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|