C22H26ClFN6O2 — CID 59353681
2-N-(3-chloro-4-fluorophenyl)-5-(2,6-dimethoxy-4-pyridinyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine (PubChem CID 59353681) has the molecular formula C22H26ClFN6O2 and a molecular weight of 460.94 g/mol. Its IUPAC name is 2-N-(3-chloro-4-fluorophenyl)-5-(2,6-dimethoxy-4-pyridinyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3-chloro-4-fluorophenyl)-5-(2,6-dimethoxy-4-pyridinyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 59353681 |
| Molecular Formula | C22H26ClFN6O2 |
| Molecular Weight | 460.94 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 2-N-(3-chloro-4-fluorophenyl)-5-(2,6-dimethoxy-4-pyridinyl)-4-N-[3-(dimethylamino)propyl]pyrimidine-2,4-diamine |
| SMILES | COc1cc(-c2cnc(Nc3ccc(F)c(Cl)c3)nc2NCCCN(C)C)cc(OC)n1 |
| InChI | InChI=1S/C22H26ClFN6O2/c1-30(2)9-5-8-25-21-16(14-10-19(31-3)28-20(11-14)32-4)13-26-22(29-21)27-15-6-7-18(24)17(23)12-15/h6-7,10-13H,5,8-9H2,1-4H3,(H2,25,26,27,29) |
| InChIKey | WHFDENOLRRDESQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 84.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.94 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|