C20H21Cl2N5O2S — CID 59354167
5-[2-(3,5-dichloroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxylic acid (PubChem CID 59354167) has the molecular formula C20H21Cl2N5O2S and a molecular weight of 466.39 g/mol. Its IUPAC name is 5-[2-(3,5-dichloroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-(3,5-dichloroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59354167 |
| Molecular Formula | C20H21Cl2N5O2S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | 5-[2-(3,5-dichloroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxylic acid |
| SMILES | CN(C)CCCNc1nc(Nc2cc(Cl)cc(Cl)c2)ncc1-c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C20H21Cl2N5O2S/c1-27(2)7-3-6-23-18-15(16-4-5-17(30-16)19(28)29)11-24-20(26-18)25-14-9-12(21)8-13(22)10-14/h4-5,8-11H,3,6-7H2,1-2H3,(H,28,29)(H2,23,24,25,26) |
| InChIKey | DNHMQXJFBWFPPU-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|