C21H32BrN7O — CID 142900549
1-[3-[[5-bromo-4-[3-(dimethylamino)propylamino]pyrimidin-2-yl]amino]phenyl]-3-pentylurea (PubChem CID 142900549) has the molecular formula C21H32BrN7O and a molecular weight of 478.44 g/mol. Its IUPAC name is 1-[3-[[5-bromo-4-[3-(dimethylamino)propylamino]pyrimidin-2-yl]amino]phenyl]-3-pentylurea.
| Compound Name | 1-[3-[[5-bromo-4-[3-(dimethylamino)propylamino]pyrimidin-2-yl]amino]phenyl]-3-pentylurea |
|---|---|
| PubChem CID | 142900549 |
| Molecular Formula | C21H32BrN7O |
| Molecular Weight | 478.44 g/mol |
| Exact Mass | 477.19 |
| IUPAC Name | 1-[3-[[5-bromo-4-[3-(dimethylamino)propylamino]pyrimidin-2-yl]amino]phenyl]-3-pentylurea |
| SMILES | CCCCCNC(=O)Nc1cccc(Nc2ncc(Br)c(NCCCN(C)C)n2)c1 |
| InChI | InChI=1S/C21H32BrN7O/c1-4-5-6-11-24-21(30)27-17-10-7-9-16(14-17)26-20-25-15-18(22)19(28-20)23-12-8-13-29(2)3/h7,9-10,14-15H,4-6,8,11-13H2,1-3H3,(H2,24,27,30)(H2,23,25,26,28) |
| InChIKey | YSBHCOQFZCWBQJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.44 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|