C29H37BrN6O — CID 142900406
(4Z)-2-amino-N-[3-[[5-bromo-4-[[(Z)-4-ethenylhex-4-enyl]amino]pyrimidin-2-yl]amino]phenyl]-4-ethenylhepta-4,6-dienamide;ethene (PubChem CID 142900406) has the molecular formula C29H37BrN6O and a molecular weight of 565.56 g/mol. Its IUPAC name is (4Z)-2-amino-N-[3-[[5-bromo-4-[[(Z)-4-ethenylhex-4-enyl]amino]pyrimidin-2-yl]amino]phenyl]-4-ethenylhepta-4,6-dienamide;ethene.
| Compound Name | (4Z)-2-amino-N-[3-[[5-bromo-4-[[(Z)-4-ethenylhex-4-enyl]amino]pyrimidin-2-yl]amino]phenyl]-4-ethenylhepta-4,6-dienamide;ethene |
|---|---|
| PubChem CID | 142900406 |
| Molecular Formula | C29H37BrN6O |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 564.22 |
| IUPAC Name | (4Z)-2-amino-N-[3-[[5-bromo-4-[[(Z)-4-ethenylhex-4-enyl]amino]pyrimidin-2-yl]amino]phenyl]-4-ethenylhepta-4,6-dienamide;ethene |
| SMILES | C=C.C=C/C=C(\C=C)CC(N)C(=O)Nc1cccc(Nc2ncc(Br)c(NCCC/C(C=C)=C/C)n2)c1 |
| InChI | InChI=1S/C27H33BrN6O.C2H4/c1-5-11-20(8-4)16-24(29)26(35)32-21-13-9-14-22(17-21)33-27-31-18-23(28)25(34-27)30-15-10-12-19(6-2)7-3;1-2/h5-9,11,13-14,17-18,24H,1-2,4,10,12,15-16,29H2,3H3,(H,32,35)(H2,30,31,33,34);1-2H2/b19-7+,20-11+; |
| InChIKey | HJQPAEUAMPPQQU-MCAVFILASA-N |
| XLogP | 7.06 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|