C15H19N3O — CID 142900367
(4Z)-2-amino-N-(3-aminophenyl)-4-ethenylhepta-4,6-dienamide (PubChem CID 142900367) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is (4Z)-2-amino-N-(3-aminophenyl)-4-ethenylhepta-4,6-dienamide.
| Compound Name | (4Z)-2-amino-N-(3-aminophenyl)-4-ethenylhepta-4,6-dienamide |
|---|---|
| PubChem CID | 142900367 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | (4Z)-2-amino-N-(3-aminophenyl)-4-ethenylhepta-4,6-dienamide |
| SMILES | C=C/C=C(\C=C)CC(N)C(=O)Nc1cccc(N)c1 |
| InChI | InChI=1S/C15H19N3O/c1-3-6-11(4-2)9-14(17)15(19)18-13-8-5-7-12(16)10-13/h3-8,10,14H,1-2,9,16-17H2,(H,18,19)/b11-6+ |
| InChIKey | DAZCODUNZTUKCP-IZZDOVSWSA-N |
| XLogP | 2.22 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|