C24H31BrN6O2 — CID 142900458
(4Z)-2-amino-4-ethenyl-N-phenylhepta-4,6-dienamide;N-[2-[(5-bromo-2-methylpyrimidin-4-yl)amino]ethyl]acetamide (PubChem CID 142900458) has the molecular formula C24H31BrN6O2 and a molecular weight of 515.46 g/mol. Its IUPAC name is (4Z)-2-amino-4-ethenyl-N-phenylhepta-4,6-dienamide;N-[2-[(5-bromo-2-methylpyrimidin-4-yl)amino]ethyl]acetamide.
| Compound Name | (4Z)-2-amino-4-ethenyl-N-phenylhepta-4,6-dienamide;N-[2-[(5-bromo-2-methylpyrimidin-4-yl)amino]ethyl]acetamide |
|---|---|
| PubChem CID | 142900458 |
| Molecular Formula | C24H31BrN6O2 |
| Molecular Weight | 515.46 g/mol |
| Exact Mass | 514.17 |
| IUPAC Name | (4Z)-2-amino-4-ethenyl-N-phenylhepta-4,6-dienamide;N-[2-[(5-bromo-2-methylpyrimidin-4-yl)amino]ethyl]acetamide |
| SMILES | C=C/C=C(\C=C)CC(N)C(=O)Nc1ccccc1.CC(=O)NCCNc1nc(C)ncc1Br |
| InChI | InChI=1S/C15H18N2O.C9H13BrN4O/c1-3-8-12(4-2)11-14(16)15(18)17-13-9-6-5-7-10-13;1-6-13-5-8(10)9(14-6)12-4-3-11-7(2)15/h3-10,14H,1-2,11,16H2,(H,17,18);5H,3-4H2,1-2H3,(H,11,15)(H,12,13,14)/b12-8+; |
| InChIKey | DLSZLDYCVWSWEO-MXZHIVQLSA-N |
| XLogP | 3.74 |
| TPSA | 122.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|