C27H28ClFN6OS — CID 59354172
N-benzyl-5-[2-(3-chloro-4-fluoroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxamide (PubChem CID 59354172) has the molecular formula C27H28ClFN6OS and a molecular weight of 539.08 g/mol. Its IUPAC name is N-benzyl-5-[2-(3-chloro-4-fluoroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxamide.
| Compound Name | N-benzyl-5-[2-(3-chloro-4-fluoroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 59354172 |
| Molecular Formula | C27H28ClFN6OS |
| Molecular Weight | 539.08 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | N-benzyl-5-[2-(3-chloro-4-fluoroanilino)-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxamide |
| SMILES | CN(C)CCCNc1nc(Nc2ccc(F)c(Cl)c2)ncc1-c1ccc(C(=O)NCc2ccccc2)s1 |
| InChI | InChI=1S/C27H28ClFN6OS/c1-35(2)14-6-13-30-25-20(17-32-27(34-25)33-19-9-10-22(29)21(28)15-19)23-11-12-24(37-23)26(36)31-16-18-7-4-3-5-8-18/h3-5,7-12,15,17H,6,13-14,16H2,1-2H3,(H,31,36)(H2,30,32,33,34) |
| InChIKey | NPQBPSZLNKQDCC-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.08 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|