C22H21F6N5O2S — CID 59354565
5-[2-[3,5-bis(trifluoromethyl)anilino]-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxylic acid (PubChem CID 59354565) has the molecular formula C22H21F6N5O2S and a molecular weight of 533.50 g/mol. Its IUPAC name is 5-[2-[3,5-bis(trifluoromethyl)anilino]-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxylic acid.
| Compound Name | 5-[2-[3,5-bis(trifluoromethyl)anilino]-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 59354565 |
| Molecular Formula | C22H21F6N5O2S |
| Molecular Weight | 533.50 g/mol |
| Exact Mass | 533.13 |
| IUPAC Name | 5-[2-[3,5-bis(trifluoromethyl)anilino]-4-[3-(dimethylamino)propylamino]pyrimidin-5-yl]thiophene-2-carboxylic acid |
| SMILES | CN(C)CCCNc1nc(Nc2cc(C(F)(F)F)cc(C(F)(F)F)c2)ncc1-c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C22H21F6N5O2S/c1-33(2)7-3-6-29-18-15(16-4-5-17(36-16)19(34)35)11-30-20(32-18)31-14-9-12(21(23,24)25)8-13(10-14)22(26,27)28/h4-5,8-11H,3,6-7H2,1-2H3,(H,34,35)(H2,29,30,31,32) |
| InChIKey | FJCVJRGQWPUWDY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.50 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|