C19H25F3N6O — CID 21081224
N-[2-[[2-[4-[2-(dimethylamino)ethyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 21081224) has the molecular formula C19H25F3N6O and a molecular weight of 410.44 g/mol. Its IUPAC name is N-[2-[[2-[4-[2-(dimethylamino)ethyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-[4-[2-(dimethylamino)ethyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 21081224 |
| Molecular Formula | C19H25F3N6O |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[2-[[2-[4-[2-(dimethylamino)ethyl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(Nc2ccc(CCN(C)C)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C19H25F3N6O/c1-13(29)23-9-10-24-17-16(19(20,21)22)12-25-18(27-17)26-15-6-4-14(5-7-15)8-11-28(2)3/h4-7,12H,8-11H2,1-3H3,(H,23,29)(H2,24,25,26,27) |
| InChIKey | VGMYFTIBBOWAEJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|