C20H25F3N6O2 — CID 21081216
N-[2-[[2-[3-(morpholin-4-ylmethyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 21081216) has the molecular formula C20H25F3N6O2 and a molecular weight of 438.45 g/mol. Its IUPAC name is N-[2-[[2-[3-(morpholin-4-ylmethyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-[3-(morpholin-4-ylmethyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 21081216 |
| Molecular Formula | C20H25F3N6O2 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-[2-[[2-[3-(morpholin-4-ylmethyl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(Nc2cccc(CN3CCOCC3)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C20H25F3N6O2/c1-14(30)24-5-6-25-18-17(20(21,22)23)12-26-19(28-18)27-16-4-2-3-15(11-16)13-29-7-9-31-10-8-29/h2-4,11-12H,5-10,13H2,1H3,(H,24,30)(H2,25,26,27,28) |
| InChIKey | HCEBVYUSVRHRLT-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 91.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|