C22H19F5N6O2 — CID 21081292
N-[4-[[4-(2-acetamidoethylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-3,5-difluorobenzamide (PubChem CID 21081292) has the molecular formula C22H19F5N6O2 and a molecular weight of 494.42 g/mol. Its IUPAC name is N-[4-[[4-(2-acetamidoethylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-3,5-difluorobenzamide.
| Compound Name | N-[4-[[4-(2-acetamidoethylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 21081292 |
| Molecular Formula | C22H19F5N6O2 |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | N-[4-[[4-(2-acetamidoethylamino)-5-(trifluoromethyl)pyrimidin-2-yl]amino]phenyl]-3,5-difluorobenzamide |
| SMILES | CC(=O)NCCNc1nc(Nc2ccc(NC(=O)c3cc(F)cc(F)c3)cc2)ncc1C(F)(F)F |
| InChI | InChI=1S/C22H19F5N6O2/c1-12(34)28-6-7-29-19-18(22(25,26)27)11-30-21(33-19)32-17-4-2-16(3-5-17)31-20(35)13-8-14(23)10-15(24)9-13/h2-5,8-11H,6-7H2,1H3,(H,28,34)(H,31,35)(H2,29,30,32,33) |
| InChIKey | YVBKMGZHOZAHMB-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 108.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|