C15H14BrClF3N5O — CID 21080712
N-[2-[[2-(4-bromo-3-chloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide (PubChem CID 21080712) has the molecular formula C15H14BrClF3N5O and a molecular weight of 452.66 g/mol. Its IUPAC name is N-[2-[[2-(4-bromo-3-chloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide.
| Compound Name | N-[2-[[2-(4-bromo-3-chloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
|---|---|
| PubChem CID | 21080712 |
| Molecular Formula | C15H14BrClF3N5O |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 451.00 |
| IUPAC Name | N-[2-[[2-(4-bromo-3-chloroanilino)-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethyl]acetamide |
| SMILES | CC(=O)NCCNc1nc(Nc2ccc(Br)c(Cl)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C15H14BrClF3N5O/c1-8(26)21-4-5-22-13-10(15(18,19)20)7-23-14(25-13)24-9-2-3-11(16)12(17)6-9/h2-3,6-7H,4-5H2,1H3,(H,21,26)(H2,22,23,24,25) |
| InChIKey | WUGHCJOFWPYUGW-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|