C14H14Cl2F3N5 — CID 67210283
2-N-(3,4-dichlorophenyl)-4-N-[2-(methylamino)ethyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 67210283) has the molecular formula C14H14Cl2F3N5 and a molecular weight of 380.20 g/mol. Its IUPAC name is 2-N-(3,4-dichlorophenyl)-4-N-[2-(methylamino)ethyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-(3,4-dichlorophenyl)-4-N-[2-(methylamino)ethyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 67210283 |
| Molecular Formula | C14H14Cl2F3N5 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-N-(3,4-dichlorophenyl)-4-N-[2-(methylamino)ethyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CNCCNc1nc(Nc2ccc(Cl)c(Cl)c2)ncc1C(F)(F)F |
| InChI | InChI=1S/C14H14Cl2F3N5/c1-20-4-5-21-12-9(14(17,18)19)7-22-13(24-12)23-8-2-3-10(15)11(16)6-8/h2-3,6-7,20H,4-5H2,1H3,(H2,21,22,23,24) |
| InChIKey | AJJLJQNAKMHALI-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 61.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|