C21H31F3N6 — CID 177203977
2-N-[2-ethyl-4-[2-(methylamino)ethylamino]phenyl]-4-N-pentyl-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 177203977) has the molecular formula C21H31F3N6 and a molecular weight of 424.52 g/mol. Its IUPAC name is 2-N-[2-ethyl-4-[2-(methylamino)ethylamino]phenyl]-4-N-pentyl-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[2-ethyl-4-[2-(methylamino)ethylamino]phenyl]-4-N-pentyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 177203977 |
| Molecular Formula | C21H31F3N6 |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 2-N-[2-ethyl-4-[2-(methylamino)ethylamino]phenyl]-4-N-pentyl-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CCCCCNc1nc(Nc2ccc(NCCNC)cc2CC)ncc1C(F)(F)F |
| InChI | InChI=1S/C21H31F3N6/c1-4-6-7-10-27-19-17(21(22,23)24)14-28-20(30-19)29-18-9-8-16(13-15(18)5-2)26-12-11-25-3/h8-9,13-14,25-26H,4-7,10-12H2,1-3H3,(H2,27,28,29,30) |
| InChIKey | NENBLHCGTNUOGF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 73.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|