C21H29F3N6S2 — CID 177203937
4-N-[3-(disulfanyl)propyl]-2-N-[2-ethyl-4-(4-methylpiperazin-1-yl)phenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine (PubChem CID 177203937) has the molecular formula C21H29F3N6S2 and a molecular weight of 486.63 g/mol. Its IUPAC name is 4-N-[3-(disulfanyl)propyl]-2-N-[2-ethyl-4-(4-methylpiperazin-1-yl)phenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(disulfanyl)propyl]-2-N-[2-ethyl-4-(4-methylpiperazin-1-yl)phenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 177203937 |
| Molecular Formula | C21H29F3N6S2 |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 4-N-[3-(disulfanyl)propyl]-2-N-[2-ethyl-4-(4-methylpiperazin-1-yl)phenyl]-5-(trifluoromethyl)pyrimidine-2,4-diamine |
| SMILES | CCc1cc(N2CCN(C)CC2)ccc1Nc1ncc(C(F)(F)F)c(NCCCSS)n1 |
| InChI | InChI=1S/C21H29F3N6S2/c1-3-15-13-16(30-10-8-29(2)9-11-30)5-6-18(15)27-20-26-14-17(21(22,23)24)19(28-20)25-7-4-12-32-31/h5-6,13-14,31H,3-4,7-12H2,1-2H3,(H2,25,26,27,28) |
| InChIKey | IUJFBPGALDQUHX-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 56.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|