C28H38F3N7O2 — CID 155269773
3-[3-[[2-[2-ethyl-4-[(1S,5R)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,3-oxazepan-2-one (PubChem CID 155269773) has the molecular formula C28H38F3N7O2 and a molecular weight of 561.65 g/mol. Its IUPAC name is 3-[3-[[2-[2-ethyl-4-[(1S,5R)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,3-oxazepan-2-one.
| Compound Name | 3-[3-[[2-[2-ethyl-4-[(1S,5R)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,3-oxazepan-2-one |
|---|---|
| PubChem CID | 155269773 |
| Molecular Formula | C28H38F3N7O2 |
| Molecular Weight | 561.65 g/mol |
| Exact Mass | 561.30 |
| IUPAC Name | 3-[3-[[2-[2-ethyl-4-[(1S,5R)-8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl]anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-1,3-oxazepan-2-one |
| SMILES | CCc1cc(N2C[C@H]3CC[C@@H](C2)N3C)ccc1Nc1ncc(C(F)(F)F)c(NCCCN2CCCCOC2=O)n1 |
| InChI | InChI=1S/C28H38F3N7O2/c1-3-19-15-20(38-17-21-7-8-22(18-38)36(21)2)9-10-24(19)34-26-33-16-23(28(29,30)31)25(35-26)32-11-6-13-37-12-4-5-14-40-27(37)39/h9-10,15-16,21-22H,3-8,11-14,17-18H2,1-2H3,(H2,32,33,34,35)/t21-,22+ |
| InChIKey | MGDGIRDJVTUEAJ-SZPZYZBQSA-N |
| XLogP | 5.12 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.65 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|