C27H36N8O2 — CID 155269814
2-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-ethylanilino]-4-[3-(2-oxo-1,3-oxazinan-3-yl)propylamino]pyrimidine-5-carbonitrile (PubChem CID 155269814) has the molecular formula C27H36N8O2 and a molecular weight of 504.64 g/mol. Its IUPAC name is 2-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-ethylanilino]-4-[3-(2-oxo-1,3-oxazinan-3-yl)propylamino]pyrimidine-5-carbonitrile.
| Compound Name | 2-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-ethylanilino]-4-[3-(2-oxo-1,3-oxazinan-3-yl)propylamino]pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 155269814 |
| Molecular Formula | C27H36N8O2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 2-[4-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-2-ethylanilino]-4-[3-(2-oxo-1,3-oxazinan-3-yl)propylamino]pyrimidine-5-carbonitrile |
| SMILES | CCc1cc(N2CCN3CCC[C@@H]3C2)ccc1Nc1ncc(C#N)c(NCCCN2CCCOC2=O)n1 |
| InChI | InChI=1S/C27H36N8O2/c1-2-20-16-22(35-14-13-33-10-3-6-23(33)19-35)7-8-24(20)31-26-30-18-21(17-28)25(32-26)29-9-4-11-34-12-5-15-37-27(34)36/h7-8,16,18,23H,2-6,9-15,19H2,1H3,(H2,29,30,31,32)/t23-/m1/s1 |
| InChIKey | MJMFMAXWXXYSCV-HSZRJFAPSA-N |
| XLogP | 3.58 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|