C24H33ClN6O3 — CID 155269798
4-[3-[[5-chloro-2-(2-ethyl-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one (PubChem CID 155269798) has the molecular formula C24H33ClN6O3 and a molecular weight of 489.02 g/mol. Its IUPAC name is 4-[3-[[5-chloro-2-(2-ethyl-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one.
| Compound Name | 4-[3-[[5-chloro-2-(2-ethyl-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one |
|---|---|
| PubChem CID | 155269798 |
| Molecular Formula | C24H33ClN6O3 |
| Molecular Weight | 489.02 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 4-[3-[[5-chloro-2-(2-ethyl-4-morpholin-4-ylanilino)pyrimidin-4-yl]amino]propyl]-1,4-oxazepan-3-one |
| SMILES | CCc1cc(N2CCOCC2)ccc1Nc1ncc(Cl)c(NCCCN2CCCOCC2=O)n1 |
| InChI | InChI=1S/C24H33ClN6O3/c1-2-18-15-19(30-10-13-33-14-11-30)5-6-21(18)28-24-27-16-20(25)23(29-24)26-7-3-8-31-9-4-12-34-17-22(31)32/h5-6,15-16H,2-4,7-14,17H2,1H3,(H2,26,27,28,29) |
| InChIKey | JWLICZLKAMDCRM-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 91.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.02 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|