C27H36F3N7O2 — CID 177204130
6-[3-[[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-3-oxa-6-azabicyclo[3.2.1]octan-7-one (PubChem CID 177204130) has the molecular formula C27H36F3N7O2 and a molecular weight of 547.63 g/mol. Its IUPAC name is 6-[3-[[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-3-oxa-6-azabicyclo[3.2.1]octan-7-one.
| Compound Name | 6-[3-[[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-3-oxa-6-azabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 177204130 |
| Molecular Formula | C27H36F3N7O2 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.29 |
| IUPAC Name | 6-[3-[[2-[2-ethyl-4-(4-methylpiperazin-1-yl)anilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]propyl]-3-oxa-6-azabicyclo[3.2.1]octan-7-one |
| SMILES | CCc1cc(N2CCN(C)CC2)ccc1Nc1ncc(C(F)(F)F)c(NCCCN2C(=O)C3COCC2C3)n1 |
| InChI | InChI=1S/C27H36F3N7O2/c1-3-18-13-20(36-11-9-35(2)10-12-36)5-6-23(18)33-26-32-15-22(27(28,29)30)24(34-26)31-7-4-8-37-21-14-19(25(37)38)16-39-17-21/h5-6,13,15,19,21H,3-4,7-12,14,16-17H2,1-2H3,(H2,31,32,33,34) |
| InChIKey | WWOYCFNJVWRATD-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 85.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|