C17H19F3N6O — CID 157275377
6-[[4-[3-(methylamino)propylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one (PubChem CID 157275377) has the molecular formula C17H19F3N6O and a molecular weight of 380.37 g/mol. Its IUPAC name is 6-[[4-[3-(methylamino)propylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one.
| Compound Name | 6-[[4-[3-(methylamino)propylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 157275377 |
| Molecular Formula | C17H19F3N6O |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 6-[[4-[3-(methylamino)propylamino]-5-(trifluoromethyl)pyrimidin-2-yl]amino]-1,3-dihydroindol-2-one |
| SMILES | CNCCCNc1nc(Nc2ccc3c(c2)NC(=O)C3)ncc1C(F)(F)F |
| InChI | InChI=1S/C17H19F3N6O/c1-21-5-2-6-22-15-12(17(18,19)20)9-23-16(26-15)24-11-4-3-10-7-14(27)25-13(10)8-11/h3-4,8-9,21H,2,5-7H2,1H3,(H,25,27)(H2,22,23,24,26) |
| InChIKey | MAYQZIOIFUIASJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 90.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|