C15H14F3N5O4S — CID 11697374
2-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethanesulfonic acid (PubChem CID 11697374) has the molecular formula C15H14F3N5O4S and a molecular weight of 417.37 g/mol. Its IUPAC name is 2-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 11697374 |
| Molecular Formula | C15H14F3N5O4S |
| Molecular Weight | 417.37 g/mol |
| Exact Mass | 417.07 |
| IUPAC Name | 2-[[2-[(2-oxo-1,3-dihydroindol-5-yl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]ethanesulfonic acid |
| SMILES | O=C1Cc2cc(Nc3ncc(C(F)(F)F)c(NCCS(=O)(=O)O)n3)ccc2N1 |
| InChI | InChI=1S/C15H14F3N5O4S/c16-15(17,18)10-7-20-14(23-13(10)19-3-4-28(25,26)27)21-9-1-2-11-8(5-9)6-12(24)22-11/h1-2,5,7H,3-4,6H2,(H,22,24)(H,25,26,27)(H2,19,20,21,23) |
| InChIKey | TYTWZMFMLUSMAD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 133.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.37 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|